51730-94-0 Usage
General Description
"(Methyl-2-phenoxyethoxy)propanol" is a complex organic chemical compound. While specific details and usage contexts vary, such compounds typically involve the presence of a methyl group - a carbon atom linked to three hydrogen atoms, and a phenoxyethoxy group- an ether that has a phenol and an ethylene glycol as its parent structures. They also feature a propanol group, which is a three-carbon chain with an alcohol group being at the end. This structure implies potential uses in a variety of chemical settings, but without specific scientific context, it's hard to say where this particular compound might be utilized. Further study and details would be necessary to delve into its particular properties, potential applications, and safety considerations.
Check Digit Verification of cas no
The CAS Registry Mumber 51730-94-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,7,3 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 51730-94:
(7*5)+(6*1)+(5*7)+(4*3)+(3*0)+(2*9)+(1*4)=110
110 % 10 = 0
So 51730-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O3/c1-11(14-9-5-8-13)10-15-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3
