51838-83-6 Usage
General Description
3,3a,7a,9b-Tetrahydro-3-(1-hydroxyethyl)-2-oxo-2H,4aH-1,4,5-trioxadicyclopent[a,hi]indene-7-carboxylic acid methyl ester is a complex chemical compound with a long and specific name. It is a methyl ester of a carboxylic acid that contains a hydroxyethyl group and a dicyclopent[a,hi]indene structure. 3,3a,7a,9b-Tetrahydro-3-(1-hydroxyethyl)-2-oxo-2H,4aH-1,4,5-trioxadicyclopent[a,hi]indene-7-carboxylic acid methyl ester belongs to the class of organic compounds known as quinoline carboxylic acids and derivatives. Its structure indicates that it contains several functional groups and has the potential to exhibit various chemical and biological properties. The complex name signifies the structure, properties, and potential reactivity of the compound, making it important for further investigation and research.
Check Digit Verification of cas no
The CAS Registry Mumber 51838-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,8,3 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 51838-83:
(7*5)+(6*1)+(5*8)+(4*3)+(3*8)+(2*8)+(1*3)=136
136 % 10 = 6
So 51838-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O7/c1-6(16)9-11-15(22-13(9)18)4-3-7-8(12(17)19-2)5-20-14(21-11)10(7)15/h3-7,9-11,14,16H,1-2H3
