519-62-0 Usage
Description
(SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium is a complex organic compound with a unique molecular structure. It is characterized by its multiple chiral centers and various functional groups, which contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Applications:
(SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium is used as a pharmaceutical compound for its potential therapeutic properties. The complex structure and various functional groups of this compound may allow it to interact with specific biological targets, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, (SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium can be used as a starting material or a building block for the synthesis of other complex organic molecules. Its unique structure and functional groups may provide new insights into the development of novel chemical reactions and synthetic strategies.
Used in Material Science:
(SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium may also find applications in material science due to its unique molecular structure and properties. It could potentially be used in the development of new materials with specific characteristics, such as improved stability, reactivity, or selectivity.
Used in Analytical Chemistry:
As a complex organic compound, (SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium can be used as a reference compound or a standard in analytical chemistry. Its unique structure and properties may be useful for the development of new analytical methods or the calibration of existing techniques.
Used in Environmental Applications:
(SP-4-2)-((2E,7R,11R)-3,7,11,15-Tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-magnesium may also have potential applications in environmental science, such as in the development of new methods for the detection, monitoring, or remediation of environmental pollutants. Its unique structure and properties could be exploited to improve the sensitivity, selectivity, or efficiency of these methods.
Biochem/physiol Actions
Chlorophyll b undergoes breakdown to form pheophytin b by the enzyme chlorophyllase. This causes a change in its color from green to olive-brown. It is involved in the harvesting of light energy during the process of photosynthesis and its subsequent conversion to chemical energy. Along with chlorophyll a, it plays a key role in the ability of a plant to adapt to different light intensities.
Purification Methods
It forms red-black hexagonal bipyramids or four-sided plates from dilute EtOH and has been recrystallised from CHCl3/MeOH. It is soluble in MeOH, EtOH, EtOAc and insoluble in pet ether. [Dougherty et al. J Am Chem Soc 88 5037 1966, Beilstein 26 III/IV 3787.]
Check Digit Verification of cas no
The CAS Registry Mumber 519-62-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,1 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 519-62:
(5*5)+(4*1)+(3*9)+(2*6)+(1*2)=70
70 % 10 = 0
So 519-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C55H71N4O6.Mg/c1-12-38-35(8)42-27-43-36(9)40(23-24-48(61)65-26-25-34(7)22-16-21-33(6)20-15-19-32(5)18-14-17-31(3)4)52(58-43)50-51(55(63)64-11)54(62)49-37(10)44(59-53(49)50)28-46-39(13-2)41(30-60)47(57-46)29-45(38)56-42;/h12,25,27-33,36,40,51H,1,13-24,26H2,2-11H3,(H-,56,57,58,59,60,62);/q-1;+2/p-1/b34-25+;/t32-,33-,36+,40+,51-;/m1./s1
519-62-0Relevant articles and documents
Der Einbau von Magnesium in Liganden der Chlorophyll-Reihe mit (2,6-Di-t-butyl-4-methylphenoxy)magnesiumjodid
Zass, Engelbert,Isenring, Hans Peter,Etter, Rolf,Eschenmoser, Albert
, p. 1048 - 1067 (2007/10/02)
Experimental details are given for the new method of introducing magnesium into porhpinoid ligands by (2,6-di-t-butyl-4-methylphenoxy)magnesium iodide (1), previously published in preliminary form .Besides magnesium octaethylporphyrinate (14), methyl pyrochlorophyllide a (10), methyl chlorophyllide a (8), and methyl bacteriochlorophyllide a (12), the complexation of pheophytin a (2) to chlorophyll a (3) and of pheophytin b (4) to chlorophyll b (5) are described.