52024-70-1 Usage
General Description
6-PHENOXY-3-PYRIDINYL ISOTHIOCYANATE is a chemical compound with the molecular formula C12H8N2O1S1. It is a member of the isothiocyanate family, which are known for their diverse range of biological activities. This specific compound is commonly used in the field of organic synthesis and pharmaceutical research due to its potential as a building block for new chemical compounds with biological activity. It possesses a phenoxy and pyridinyl functional group, which are important for its reactivity and biological properties. Additionally, the isothiocyanate moiety in the molecule is known for its potential anticancer, antimicrobial, and antioxidant properties, making 6-PHENOXY-3-PYRIDINYL ISOTHIOCYANATE a valuable compound for further investigation in various fields of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 52024-70-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,2 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52024-70:
(7*5)+(6*2)+(5*0)+(4*2)+(3*4)+(2*7)+(1*0)=81
81 % 10 = 1
So 52024-70-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2OS/c16-9-14-10-6-7-12(13-8-10)15-11-4-2-1-3-5-11/h1-8H
52024-70-1Relevant articles and documents
Isothiocyanopyridine derivatives
-
, (2008/06/13)
New isothiocyanopyridines of the formula STR1 wherein R1 represents hydrogen, alkyl, substituted alkyl, cycloalkyl, Cycloalkenyl, or a group of the formula STR2 WHEREIN R3, R4 and R5 stand for hydrogen, alkyl, p
Xn:Harmful;
