52497-68-4 Usage
Description
THYMIDINE, [METHYL-3H] is a radioactive form of thymidine, a nucleoside that plays a crucial role in the synthesis of DNA. This chemical is specifically labeled with tritium at the methyl group, which endows it with unique properties that make it an invaluable tool for various scientific applications. Its radioactive nature allows researchers to track and study DNA replication, repair, and metabolism processes in detail.
Uses
Used in Molecular Biology and Biochemistry Research:
THYMIDINE, [METHYL-3H] is used as a research tool for investigating DNA-related processes. Its incorporation into DNA allows scientists to study the mechanisms of DNA synthesis, repair, and the overall metabolism of the molecule.
Used in Radioisotope Labeling Experiments:
In radioisotope labeling experiments, THYMIDINE, [METHYL-3H] is used as a tracer to track the incorporation of thymidine into DNA. This application is essential for measuring DNA synthesis rates and understanding how DNA replication occurs within living organisms.
Used in Autoradiography:
THYMIDINE, [METHYL-3H] is utilized in autoradiography, a technique that combines photography with radioactivity to visualize the distribution of radioactive material within a sample. This method is particularly useful for studying the localization and dynamics of DNA synthesis in cells.
Used in In Vitro Nucleic Acid Hybridization Studies:
In in vitro nucleic acid hybridization studies, THYMIDINE, [METHYL-3H] serves as a labeled probe to detect and analyze specific DNA or RNA sequences. The radioactive signal allows for the precise identification and quantification of target nucleic acid sequences, which is vital for various genetic and molecular studies.
Check Digit Verification of cas no
The CAS Registry Mumber 52497-68-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,4,9 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 52497-68:
(7*5)+(6*2)+(5*4)+(4*9)+(3*7)+(2*6)+(1*8)=144
144 % 10 = 4
So 52497-68-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i1T3
