52691-91-5 Usage
Description
1,4-Naphthalenedione, 2-methyl-3-((3-methyl-3-(4,8,12-trimethyltridecy l)oxiranyl)methyl)is a complex organic compound with a unique chemical structure. It is characterized by its naphthalenedione core, which is a derivative of naphthalene with two carbonyl groups at the 1 and 4 positions. The molecule also contains a methyl group, an oxiranyl group, and a trimethyltridecyl group, which contribute to its specific properties and potential applications.
Uses
1. Used in Pharmaceutical Industry:
1,4-Naphthalenedione, 2-methyl-3-((3-methyl-3-(4,8,12-trimethyltridecy l)oxiranyl)methyl)is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the development of new drugs with specific therapeutic properties.
2. Used in Chemical Research:
1,4-Naphthalenedione, 2-methyl-3-((3-methyl-3-(4,8,12-trimethyltridecy l)oxiranyl)methyl)is also utilized in chemical research for studying the properties and reactivity of naphthalenedione derivatives. It can be used to explore new reaction pathways and develop innovative synthetic methods for the preparation of complex organic molecules.
3. Used in Material Science:
The unique structure of 1,4-Naphthalenedione, 2-methyl-3-((3-methyl-3-(4,8,12-trimethyltridecy l)oxiranyl)methyl)makes it a potential candidate for the development of new materials with specific properties. It can be used in the design and synthesis of advanced materials for various applications, such as in electronics, optics, or as components in advanced composites.
4. Used in Impurity Analysis:
As an impurity of Vitamin K1, this compound can be used in the analysis and quality control of pharmaceutical products containing Vitamin K1. Understanding the presence and effects of such impurities is crucial for ensuring the safety and efficacy of the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 52691-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,6,9 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 52691-91:
(7*5)+(6*2)+(5*6)+(4*9)+(3*1)+(2*9)+(1*1)=135
135 % 10 = 5
So 52691-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C31H46O3/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-19-31(6)28(34-31)20-27-24(5)29(32)25-17-7-8-18-26(25)30(27)33/h7-8,17-18,21-23,28H,9-16,19-20H2,1-6H3