5270-73-5 Usage
General Description
Hydroxyethyloxamic acid, also known as HELOA, is a chemical compound with the formula C2H5NO3. It is a chelating agent with the ability to bind to metal ions, particularly heavy metals such as uranium, thorium, and copper. HELOA is primarily used in the extraction and separation of these metals from ores, as well as in the treatment of industrial wastewater containing heavy metal contaminants. It forms stable complexes with metal ions, enabling their removal from solution through precipitation or solvent extraction. HELOA is often used in combination with other reagents to optimize metal recovery and minimize environmental impact. Additionally, it has potential applications in the pharmaceutical and agricultural industries due to its chelating properties and potential toxicity against certain microorganisms. Overall, hydroxyethyloxamic acid plays a significant role in metal recovery and environmental remediation processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5270-73-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,7 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5270-73:
(6*5)+(5*2)+(4*7)+(3*0)+(2*7)+(1*3)=85
85 % 10 = 5
So 5270-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H7NO4/c6-2-1-5-3(7)4(8)9/h6H,1-2H2,(H,5,7)(H,8,9)
