52771-99-0 Usage
General Description
5-Nitro-1,3-dihydroisobenzofuran is a chemical compound with the molecular formula C8H7NO3. It is a nitro-substituted derivative of 1,3-dihydroisobenzofuran, which is a bicyclic organic compound. This chemical is commonly used in organic synthesis and pharmaceutical research due to its unique structural properties and potential medicinal applications. The nitro group in 5-Nitro-1,3-dihydroisobenzofuran makes it a versatile intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. Additionally, the compound has been studied for its potential biological activities, such as antimicrobial and anticancer properties, making it an important target for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 52771-99-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,7,7 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 52771-99:
(7*5)+(6*2)+(5*7)+(4*7)+(3*1)+(2*9)+(1*9)=140
140 % 10 = 0
So 52771-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO3/c10-9(11)8-2-1-6-4-12-5-7(6)3-8/h1-3H,4-5H2
52771-99-0Relevant articles and documents
6-MEMBERED HETEROCYCLIC DERIVATIVE AND PHARMACEUTICAL COMPOSITION COMPRISING SAME
-
Paragraph 0585; 0586, (2018/03/25)
A compound represented by Formula (I): wherein or the like Y1 is O or the like; Z1 is C(R4) or N; Z2a is C(R5a) or the like; Z3a is C(R6) or the like; R4, R5a and R6 are each independently a hydrogen atom or the like; R1 is substituted or unsubstituted aromatic carbocyclyl or the like; R2a, R2b, R2c and R2d are each independently a hydrogen atom or the like; X is N(R7a) or the like; R7a is a hydrogen atom or the like; R3 is or the like Ring B is a 6-membered aromatic carbocycle or the like; R9a and R10a are each independently halogen or the like; n is an integer from 1 to 5; m is an integer from 0 to 4; and p1 is an integer from 0 to 3, or a pharmaceutically acceptable salt thereof.
Imidazo pyridine-2-ones and pharmaceutical compositions and methods of treatment utilizing same
-
, (2008/06/13)
1,3-Dihydroimidazo[4,5-b]pyridin-2-ones and corresponding thiones have utility as analgesic, antipyretic and antiinflammatory agents. They are generally prepared by treatment of a 2,3-diaminopyridine with phosgene or thiosphosgene followed by further substitution if desired.