528-75-6 Usage
Description
2,4-Dinitrobenzaldehyde is an organic compound that belongs to the class of aromatic aldehydes. It is characterized by the presence of two nitro groups (-NO2) at the 2nd and 4th positions of a benzene ring, with an aldehyde group (-CHO) attached to the carbonyl carbon. 2,4-Dinitrobenzaldehyde exhibits a yellow to light brown crystalline appearance and has a melting point of 72°C. It is soluble in various organic solvents such as ethanol, ether, benzene, and glacial acetic acid, while it is only slightly soluble in water. Due to its chemical structure, 2,4-dinitrobenzaldehyde can easily sublimate when exposed to heat.
Uses
1. Used in Organic Synthesis:
2,4-Dinitrobenzaldehyde is used as a reagent in the preparation of Schiff bases, which are essential intermediates in the synthesis of various organic compounds, including pharmaceuticals, dyes, and other specialty chemicals. Schiff bases are formed by the condensation of an amine with an aldehyde or ketone, and the presence of the nitro groups in 2,4-dinitrobenzaldehyde allows for the formation of stable and versatile Schiff base derivatives.
2. Used in Analytical Chemistry:
Due to its unique chemical properties, 2,4-dinitrobenzaldehyde can be employed as a reagent in analytical chemistry for the detection and quantification of various compounds. For instance, it can be used to identify primary amines through the formation of colored Schiff bases, which can then be analyzed spectrophotometrically.
3. Used in the Pharmaceutical Industry:
In the pharmaceutical industry, 2,4-dinitrobenzaldehyde can be utilized as a starting material for the synthesis of various therapeutic agents. Its ability to form Schiff bases with amines makes it a valuable building block for the development of novel drugs with potential applications in treating various diseases and medical conditions.
4. Used in the Dye Industry:
The versatility of 2,4-dinitrobenzaldehyde in forming Schiff bases also makes it a valuable compound in the dye industry. The resulting colored complexes can be used to produce a wide range of dyes with different shades and hues, which can be applied in various industries such as textiles, plastics, and printing.
5. Used in the Research and Development of New Materials:
The unique chemical properties of 2,4-dinitrobenzaldehyde also make it a valuable compound in the research and development of new materials. Its ability to form stable complexes with various organic and inorganic compounds can lead to the discovery of new materials with unique properties and potential applications in various fields, such as electronics, energy storage, and environmental remediation.
Check Digit Verification of cas no
The CAS Registry Mumber 528-75-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 528-75:
(5*5)+(4*2)+(3*8)+(2*7)+(1*5)=76
76 % 10 = 6
So 528-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-4H
528-75-6Relevant articles and documents
Highly atom efficient synthesis of 2,2,4,5-tetrasubstituted 3(2H)-furanones having both hydroxyl and amino substituents
Antony, Jesna,Mathai, Sindhu,Natarajan, Rakesh,P. Musthafa, Sumi,Rappai, John P.,S. Devaky, Karakkattu
supporting information, (2022/02/25)
We have developed a highly atom efficient synthesis of tetrasubstituted 3(2H)-furanones from easily accessible starting materials such as C,N-diarylaldonitrones and dibenzoylacetylene. Control experiments revealed that reaction of aldonitrones having electron-withdrawing groups on the C-aryl substituent in polar aprotic solvents exhibited high product selectivity while reaction temperature has only a negligible effect on product yield and selectivity.
Visible-light mediated facile dithiane deprotection under metal free conditions
Dharpure, Pankaj D.,Bhowmick, Anindita,Warghude, Prakash K.,Bhat, Ramakrishna G.
, (2019/12/09)
Visible light mediated facile and selective dithiane deprotection under metal free conditions is developed. Eosin Y (1 mol%) proved to be an effective catalyst for the dithiane deprotection under the ambient photoredox conditions. The standard household compact fluorescent light source (CFL bulb) proved to be effective under open-air conditions in aqueous acetonitrile at room temperature. The protocol that exhibits a broad substrate scope and functional group tolerance has been shown to expand to a range of transformations for the electron-rich and -deficient thioacetals and thioketals. The synthetic utility of this protocol has also been demonstrated by gram-scale application.
Enantioselective synthesis of diarylcyclopropanecarboaldehydes by organocatalysis
Chen, Xuyun,Yu, Yang,Liao, Ziyang,Li, Hao,Wang, Wei
, p. 5742 - 5745 (2016/12/03)
An efficient synthetic method for chiral trisubstituted diarylcyclopropanecarboaldehydes has been developed from substituted benzyl chloride and α,β-unsaturated aldehydes. The reactions were catalyzed by chiral amine catalyst under mild condition to afford the chiral diarylcyclopropanecarboaldehydes in good to high yields and up to excellent enantioselectivities.
