52853-54-0 Usage
Description
3,6-DIMETHYL-3H-BENZOTHIAZOL-2-YLIDENEAMINE is an organic compound with the molecular formula C9H8N2S. It is a derivative of benzothiazole, a heterocyclic compound consisting of a benzene ring fused to a thiazole ring. 3,6-DIMETHYL-3H-BENZOTHIAZOL-2-YLIDENEAMINE is characterized by the presence of two methyl groups at the 3rd and 6th positions and an imine functional group at the 2nd position. It is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural features.
Uses
Used in Chemical Synthesis:
3,6-DIMETHYL-3H-BENZOTHIAZOL-2-YLIDENEAMINE is used as a reactant in the preparation of benzothiazole and related compounds. It serves as a key intermediate in the synthesis of various benzothiazole derivatives, which are important in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,6-DIMETHYL-3H-BENZOTHIAZOL-2-YLIDENEAMINE is used as a building block for the development of novel drug candidates. Its unique structure and reactivity make it a valuable component in the design and synthesis of new molecules with potential therapeutic applications.
Used in Material Science:
3,6-DIMETHYL-3H-BENZOTHIAZOL-2-YLIDENEAMINE can also be utilized in the field of material science, particularly in the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved stability, conductivity, or optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 52853-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,5 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52853-54:
(7*5)+(6*2)+(5*8)+(4*5)+(3*3)+(2*5)+(1*4)=130
130 % 10 = 0
So 52853-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2S/c1-6-3-4-7-8(5-6)12-9(10)11(7)2/h3-5,10H,1-2H3/b10-9-
