52938-91-7 Usage
General Description
2,4-Dicyclopentylphenol is a chemical compound with the molecular formula C17H24O. It is a phenolic compound and a derivative of cyclopentylphenol, with two cyclopentyl rings attached to the benzene ring. This chemical is commonly used as a raw material in the synthesis of pharmaceuticals, pesticides, and other organic compounds. It is also known for its antifungal and antibacterial properties, making it useful in various industrial and agricultural applications. Additionally, 2,4-Dicyclopentylphenol is being studied for its potential therapeutic properties, particularly in the fields of oncology and neurology. However, its toxicological properties and potential environmental impact warrant further investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 52938-91-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,9,3 and 8 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 52938-91:
(7*5)+(6*2)+(5*9)+(4*3)+(3*8)+(2*9)+(1*1)=147
147 % 10 = 7
So 52938-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H22O/c17-16-10-9-14(12-5-1-2-6-12)11-15(16)13-7-3-4-8-13/h9-13,17H,1-8H2