532924-25-7 Usage
Description
5-Chloro-2-nitrophenylboronic acid is a chemical compound that is a derivative of phenylboronic acid, characterized by the presence of a chlorine atom at the 5th position and a nitro group at the 2nd position on the phenyl ring. It is known for its versatile reactivity and is widely utilized in the synthesis of various pharmaceutical products.
Uses
Used in Pharmaceutical Industry:
5-Chloro-2-nitrophenylboronic acid is used as an intermediate in the synthesis of various pharmaceutical products due to its unique chemical structure and reactivity. It plays a crucial role in the development of new drugs and medicines, contributing to the advancement of healthcare and medical treatments.
Used in Organic Synthesis:
In the field of organic chemistry, 5-Chloro-2-nitrophenylboronic acid is employed as a key building block for the creation of complex organic molecules. Its specific functional groups allow for a range of reactions, making it a valuable compound in the synthesis of various organic compounds with potential applications in different industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 532924-25-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,2,9,2 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 532924-25:
(8*5)+(7*3)+(6*2)+(5*9)+(4*2)+(3*4)+(2*2)+(1*5)=147
147 % 10 = 7
So 532924-25-7 is a valid CAS Registry Number.
InChI:InChI=1S/C6H5BClNO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3,10-11H
