53464-72-5 Usage
Description
8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE is a chemical compound with the molecular formula C23H42ClNO4. It is a white solid that belongs to the class of benzoate derivatives. 8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE is characterized by its octyl chain with a diethylamino group at the 8th position and three methoxy groups at the 3rd, 4th, and 5th positions of the benzene ring. Its chemical structure endows it with unique properties, making it suitable for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE is used as a calcium antagonist for the treatment of various cardiovascular diseases. It helps in regulating the flow of calcium ions across cell membranes, which is crucial for maintaining the proper functioning of the heart and blood vessels. By acting as a calcium antagonist, this compound can help in reducing blood pressure, preventing arrhythmias, and alleviating the symptoms of angina.
8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE is also used as a protein kinase C inhibitor in the pharmaceutical industry. Protein kinase C is an enzyme that plays a significant role in various cellular processes, including cell growth, differentiation, and apoptosis. Inhibiting the activity of protein kinase C can be beneficial in treating certain diseases, such as cancer, where the uncontrolled growth and proliferation of cells are the primary concerns.
Used in Chemical Research:
8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE can be used as a research compound in the field of chemical synthesis and drug discovery. Its unique chemical structure makes it an interesting candidate for the development of new drugs and therapeutic agents. Researchers can use this compound as a starting material or a building block for the synthesis of more complex molecules with potential applications in various industries.
Used in Cosmetics Industry:
Due to its chemical properties, 8-(DIETHYLAMINO)OCTYL 3,4,5-TRIMETHOXYBENZOATE HYDROCHLORIDE can be used in the cosmetics industry as an active ingredient in various skincare and hair care products. Its ability to modulate cellular processes and interact with proteins may provide potential benefits for skin health and hair growth. It can be used in formulations targeting anti-aging, skin rejuvenation, and hair growth promotion.
Check Digit Verification of cas no
The CAS Registry Mumber 53464-72-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,4,6 and 4 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 53464-72:
(7*5)+(6*3)+(5*4)+(4*6)+(3*4)+(2*7)+(1*2)=125
125 % 10 = 5
So 53464-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H37NO5/c1-6-23(7-2)14-12-10-8-9-11-13-15-28-22(24)18-16-19(25-3)21(27-5)20(17-18)26-4/h16-17H,6-15H2,1-5H3/p+1