535-75-1 Usage
Description
DL-Pipecolinic acid, also known as 2-piperidinecarboxylic acid, is a white to light beige fine crystalline powder with chemical properties that make it a versatile compound in various applications. It is a piperidine monocarboxylic acid in which the carboxy group is located at position C-2.
Uses
1. Used in Diagnostics:
DL-Pipecolinic acid is used as a diagnostic marker for pyridoxine-dependent epilepsy, a rare genetic disorder that requires specific treatment and monitoring.
2. Used in Chemical Synthesis:
DL-Pipecolinic acid acts as a ligand in the copper-catalyzed approach for P-arylation of organophosphorus compounds, which is an important process in the synthesis of various chemical compounds.
3. Used in Organic Synthesis:
DL-Pipecolinic acid serves as an organocatalyst and a novel substrate in organic synthesis, contributing to the development of new chemical reactions and the synthesis of complex molecules.
4. Used in Pharmaceutical Industry:
As an organocatalyst and substrate, DL-Pipecolinic acid plays a significant role in the pharmaceutical industry, where it is used to develop new drugs and improve the synthesis of existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 535-75-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,3 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 535-75:
(5*5)+(4*3)+(3*5)+(2*7)+(1*5)=71
71 % 10 = 1
So 535-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)
