53554-30-6 Usage
Description
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is a chemical compound with the molecular formula C7H10N4O. It is a derivative of pyrimidine and has two methyl groups attached to the 2 and 4 positions of the pyrimidine ring. 5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is known for its versatile reactivity and structural properties, making it a valuable building block in various applications.
Uses
Used in Pharmaceutical Synthesis:
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs and therapeutic agents.
Used in Agrochemical Production:
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is also utilized in the production of agrochemicals, where its reactivity and structural properties are leveraged to create effective products for agricultural applications.
Used in Dye and Pigment Manufacturing:
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is used as a component in the manufacturing of dyes and pigments, contributing to the color and stability of these products.
Used in Organic Intermediates Production:
In the chemical industry, this compound serves as an important organic intermediate, playing a crucial role in the synthesis of various chemical products.
Used in Medicinal Chemistry Research:
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) may have potential applications in the field of medicinal chemistry, where it can be explored for its properties and used in the development of innovative treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 53554-30-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,5 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 53554-30:
(7*5)+(6*3)+(5*5)+(4*5)+(3*4)+(2*3)+(1*0)=116
116 % 10 = 6
So 53554-30-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O/c1-4-6(7(8)11)3-9-5(2)10-4/h3H,1-2H3,(H2,8,11)
