53598-01-9 Usage
Description
H-ARG(OH)-OH ACOH, also known as L-arginine, is an amino acid that plays a crucial role in various biological processes. It is a conditionally essential amino acid, meaning that it can be synthesized by the body under normal circumstances, but it may become essential under certain conditions, such as illness or increased metabolic demand. L-arginine has a guanidino group, making it a potent precursor for the synthesis of nitric oxide (NO), a molecule with significant vasodilatory and immunomodulatory properties.
Uses
Used in Pharmaceutical Applications:
H-ARG(OH)-OH ACOH is used as a precursor for the biosynthesis of nitric oxide (NO) from arginine. Nitric oxide is a vital signaling molecule involved in various physiological processes, including vasodilation, immune response, and neurotransmission. L-arginine supplementation has been explored for its potential benefits in conditions such as cardiovascular disease, erectile dysfunction, and wound healing.
Used in Cardiovascular Applications:
H-ARG(OH)-OH ACOH is used as a vasodilator for promoting arterial vasorelaxation. The increased production of nitric oxide (NO) from L-arginine leads to the relaxation of smooth muscle cells in blood vessels, resulting in improved blood flow and reduced blood pressure. This property makes L-arginine a potential therapeutic agent for the prevention and treatment of cardiovascular diseases, such as atherosclerosis, hypertension, and peripheral artery disease.
Used in Sports Nutrition:
L-arginine is used as a sports supplement to enhance exercise performance and promote muscle growth. The increased production of nitric oxide (NO) from L-arginine can improve blood flow to working muscles, potentially leading to enhanced endurance, reduced muscle fatigue, and improved recovery. Additionally, L-arginine may stimulate the release of growth hormone, which can promote muscle growth and repair.
Used in Antioxidant Applications:
H-ARG(OH)-OH ACOH has been shown to possess antioxidant properties, which can help protect cells from damage caused by reactive oxygen species (ROS). The increased production of nitric oxide (NO) from L-arginine can help neutralize ROS, reducing oxidative stress and potentially lowering the risk of various diseases, such as cancer, neurodegenerative disorders, and aging-related conditions.
Used in Research Applications:
L-arginine is used as a research tool to study the role of nitric oxide (NO) in various biological processes. By manipulating the availability of L-arginine in experimental systems, researchers can gain insights into the mechanisms underlying NO-mediated signaling pathways and their implications in health and disease.
Biochem/physiol Actions
Intermediate in the conversion of arginine to NO and citrulline by NO synthase.
Check Digit Verification of cas no
The CAS Registry Mumber 53598-01-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,9 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 53598-01:
(7*5)+(6*3)+(5*5)+(4*9)+(3*8)+(2*0)+(1*1)=139
139 % 10 = 9
So 53598-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H14N4O3.C2H4O2/c7-4(5(11)12)2-1-3-9-6(8)10-13;1-2(3)4/h4,13H,1-3,7H2,(H,11,12)(H3,8,9,10);1H3,(H,3,4)/t4-;/m0./s1