53646-01-8 Usage
Description
(1-chloropropan-2-ylideneamino)urea, with the molecular formula C4H8ClN3O, is an organic compound that falls under the category of ureas. It is recognized for its diverse applications across various industries due to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
(1-chloropropan-2-ylideneamino)urea is used as an intermediate in the synthesis of various biologically active compounds, playing a crucial role in the development of pharmaceutical products.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, this compound serves as an intermediate, contributing to the creation of substances that help in the management and protection of crops.
Used in Materials Science:
(1-chloropropan-2-ylideneamino)urea may also find applications in the field of materials science, where its unique properties could be leveraged to develop new materials with specific characteristics.
Used in Organic Chemistry:
Its potential uses extend to the realm of organic chemistry, where it could be key in the synthesis of a range of organic compounds for various purposes.
Used in Medicinal Chemistry:
Furthermore, (1-chloropropan-2-ylideneamino)urea holds promise in medicinal chemistry for the development of novel drug molecules, potentially leading to advancements in healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 53646-01-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,4 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 53646-01:
(7*5)+(6*3)+(5*6)+(4*4)+(3*6)+(2*0)+(1*1)=118
118 % 10 = 8
So 53646-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8ClN3O/c1-3(2-5)7-8-4(6)9/h2H2,1H3,(H3,6,8,9)/b7-3+
