53663-14-2 Usage
General Description
7-Nitro-1-mercura-2-oxaindan-3-one, also known as NMI, is a chemical compound that is commonly used as a reagent in organic synthesis. It is a versatile and highly reactive compound that is known for its ability to form stable and selective complexes with various metals and metal ions. NMI is also used as a chelating agent and has been utilized in the coordination chemistry of transition metals. Additionally, it has been employed as a catalyst in various chemical reactions, including the synthesis of organic compounds and the transformation of functional groups. Its unique structure and properties make it a valuable tool in the field of organic chemistry and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 53663-14-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,6 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 53663-14:
(7*5)+(6*3)+(5*6)+(4*6)+(3*3)+(2*1)+(1*4)=122
122 % 10 = 2
So 53663-14-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H4NO4.Hg/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-3H,(H,9,10);/rC7H4HgNO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11)