5382-23-0 Usage
Description
4-Chloro-1-methylpiperidine hydrochloride, with the chemical formula C6H12ClNO·HCl and CAS number 5382-23-0, is an organic compound that serves as a valuable intermediate in the synthesis of various pharmaceuticals and organic compounds. Its structure features a piperidine ring with a methyl group at the first position and a chlorine atom at the fourth position, which is then protonated to form the hydrochloride salt. 4-Chloro-1-methylpiperidine hydrochloride is known for its reactivity and potential applications in the development of new drugs and chemical products.
Uses
Used in Pharmaceutical Industry:
4-Chloro-1-methylpiperidine hydrochloride is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, such as antidepressants, antipsychotics, and other central nervous system agents. The presence of the chlorine atom and the methyl group on the piperidine ring provides opportunities for further chemical modifications, enabling the creation of diverse drug candidates with improved pharmacological properties.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Chloro-1-methylpiperidine hydrochloride serves as a versatile building block for the preparation of a wide range of organic compounds. Its reactivity allows for various chemical reactions, such as nucleophilic substitutions, additions, and rearrangements, which can be utilized to synthesize complex organic molecules with specific functionalities. This makes it a valuable tool for researchers and chemists working on the development of new materials, agrochemicals, and specialty chemicals.
Used in Research and Development:
4-Chloro-1-methylpiperidine hydrochloride is also used in research and development settings to explore its chemical properties and potential applications. Scientists and researchers can use this compound to study its reactivity, stability, and interactions with other molecules, which can lead to the discovery of new chemical reactions and the development of innovative synthetic methods. Additionally, its use in research can contribute to a better understanding of the structure-activity relationships of piperidine-based compounds, guiding the design of more effective drugs and chemical products.
Flammability and Explosibility
Pyrophoric
Check Digit Verification of cas no
The CAS Registry Mumber 5382-23-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,8 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5382-23:
(6*5)+(5*3)+(4*8)+(3*2)+(2*2)+(1*3)=90
90 % 10 = 0
So 5382-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H12ClN/c1-8-4-2-6(7)3-5-8/h6H,2-5H2,1H3/p+1
5382-23-0Relevant articles and documents
Substituted chromans
-
, (2008/06/13)
The invention relates to chroman derivatives of the general formula STR1 wherein R1 is hydrogen, lower alkyl, substituted phenyl, phenyl, phenyl-lower alkyl, substituted phenyl-lower alkyl or lower alkyl-amino-lower alkyl; R2 is STR2 R3, R4, R5 and R6 each is independently selected from hydrogen, hydroxy, amino, -o-acyl, -o-lower alkyl; STR3 halogen, lower alkyl, or halo substituted lower alkyl; and salts and hydrates thereof. These compounds are useful as anti-inflammatory agents; for inhibition of blood platelet aggregation, as antiallergy and as antihypertensive agents.
