54053-42-8 Usage
Description
(S)-(-)-N,N-Dimethyl-1-ferrocenylethylamine is a chiral ferrocene derivative with the chemical formula C14H17NFe. It features a dimethylaminoethyl substituent and is known for its stability and redox properties due to the ferrocene moiety in its structure. The enantiopure nature of this compound makes it a valuable reagent in various synthetic and catalytic applications.
Uses
Used in Organometallic Chemistry:
(S)-(-)-N,N-Dimethyl-1-ferrocenylethylamine is used as a ligand for organometallic chemistry applications due to its ability to mediate and control reactions, providing enhanced stability and selectivity.
Used in Catalysis:
In the field of catalysis, (S)-(-)-N,N-Dimethyl-1-ferrocenylethylamine is utilized as a ligand to improve the efficiency and selectivity of various chemical reactions, taking advantage of its redox properties and chiral characteristics.
Used in Asymmetric Synthesis:
(S)-(-)-N,N-Dimethyl-1-ferrocenylethylamine is employed as a reagent in asymmetric synthesis, where its enantiopure nature allows for the creation of chiral molecules with specific configurations, which is crucial in pharmaceutical and chemical industries.
Used in Chiral Resolution Processes:
(S)-(-)-N,N-Dimethyl-1-ferrocenylethylamine is also used in chiral resolution processes, where the separation of enantiomers is required to obtain pure chiral compounds for applications in various industries, such as pharmaceuticals, where the desired biological activity is often associated with a specific enantiomer.
Check Digit Verification of cas no
The CAS Registry Mumber 54053-42-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,0,5 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 54053-42:
(7*5)+(6*4)+(5*0)+(4*5)+(3*3)+(2*4)+(1*2)=98
98 % 10 = 8
So 54053-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N.C5H4.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-6,8H,1-3H3;1-4H;/q2*-1;+2/t8-;;/m0../s1/rC14H17FeN/c1-11(16(2)3)13-9-6-10-14(13)15-12-7-4-5-8-12/h4-11H,1-3H3/t11-/m0/s1