5423-96-1 Usage
Description
4,7-dichloro-2-methoxyacridine is a chemical compound with the molecular formula C14H10Cl2NO. It is a derivative of acridine, characterized by its bright yellow crystalline solid appearance and a melting point of 168-170°C. 4,7-dichloro-2-methoxyacridine is known for its applications in pharmaceutical and organic chemistry research.
Uses
Used in Pharmaceutical Industry:
4,7-dichloro-2-methoxyacridine is used as an intermediate in the synthesis of various pharmaceuticals for its potential biological and pharmacological activities. Its role in creating new drug formulations is crucial due to its unique chemical structure.
Used in Organic Chemistry Research:
In the field of organic chemistry, 4,7-dichloro-2-methoxyacridine serves as a valuable research compound. It aids scientists in understanding and developing new organic compounds and dyes through its chemical properties and reactivity.
Used in Production of Antimicrobial Agents:
4,7-dichloro-2-methoxyacridine is utilized in the production of antimicrobial agents, highlighting its importance in the development of substances that can combat various types of infections.
However, it is essential to handle 4,7-dichloro-2-methoxyacridine with caution due to its potential hazardous and toxic nature. Proper safety measures should be taken to minimize any risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 5423-96-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5423-96:
(6*5)+(5*4)+(4*2)+(3*3)+(2*9)+(1*6)=91
91 % 10 = 1
So 5423-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H9ClF2O3/c16-11-7-13(18)12(17)6-10(11)15(20)21-8-14(19)9-4-2-1-3-5-9/h1-7H,8H2
