5424-66-8 Usage
Description
2-BIPHENYL-4-YL-PYRROLIDINE is an organic compound with the molecular structure featuring a pyrrolidine ring fused to a biphenyl group. It is a versatile reactant in the synthesis of various chemical compounds and has potential applications in different industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
2-BIPHENYL-4-YL-PYRROLIDINE is used as a reactant for the preparation of cycloalkanes, which are essential building blocks in the synthesis of various pharmaceutical compounds. The process involves sulfonylazidonation, Curtius rearrangement, ring contraction of cyclo azaalkanes/oxazalkanes, and other chemical reactions to create diverse molecular structures with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-BIPHENYL-4-YL-PYRROLIDINE serves as a key reactant for creating cycloalkanes through a series of chemical reactions. These cycloalkanes can be further modified and functionalized to produce a wide range of chemical products with various applications, such as in materials science, agrochemicals, and specialty chemicals.
Used in Research and Development:
2-BIPHENYL-4-YL-PYRROLIDINE is also utilized in research and development laboratories for exploring new synthetic routes and methodologies. Its unique structural features make it an attractive candidate for studying novel chemical reactions and developing innovative synthetic strategies, which can potentially lead to the discovery of new compounds with improved properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5424-66-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 4 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5424-66:
(6*5)+(5*4)+(4*2)+(3*4)+(2*6)+(1*6)=88
88 % 10 = 8
So 5424-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H17N/c1-2-5-13(6-3-1)14-8-10-15(11-9-14)16-7-4-12-17-16/h1-3,5-6,8-11,16-17H,4,7,12H2/p+1/t16-/m1/s1
