5440-26-6 Usage
Description
(3Z)-3-hydroxyimino-4-(4-hydroxyphenyl)butan-2-one is a ketoxime derivative of 4-hydroxyphenyl butanone with the molecular formula C10H11NO3. It features a hydroxyimino group at the 3-position and a hydroxy group at the 4-position of the phenyl ring. This chemical compound is of interest in scientific and industrial fields due to its properties and potential applications.
Uses
Used in Organic Synthesis:
(3Z)-3-hydroxyimino-4-(4-hydroxyphenyl)butan-2-one is used as an intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Research:
In the field of chemical research, (3Z)-3-hydroxyimino-4-(4-hydroxyphenyl)butan-2-one serves as a subject of study for understanding the reactivity and properties of ketoxime derivatives. Researchers use this compound to explore new reaction pathways, develop innovative synthetic methods, and gain insights into the behavior of similar molecules.
Used in Pharmaceutical Applications:
Due to its structural similarity to other bioactive compounds, (3Z)-3-hydroxyimino-4-(4-hydroxyphenyl)butan-2-one may have potential pharmaceutical applications. It could be utilized as a lead compound in drug discovery, where its structure can be further optimized to develop new therapeutic agents with specific biological activities.
Used in Analytical Chemistry:
(3Z)-3-hydroxyimino-4-(4-hydroxyphenyl)butan-2-one can also be employed in analytical chemistry as a reference compound or standard for the development and validation of analytical methods. Its distinct chemical properties make it suitable for use in chromatographic, spectroscopic, and other analytical techniques to ensure accurate measurements and assessments of chemical systems.
Check Digit Verification of cas no
The CAS Registry Mumber 5440-26-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5440-26:
(6*5)+(5*4)+(4*4)+(3*0)+(2*2)+(1*6)=76
76 % 10 = 6
So 5440-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO3/c1-7(12)10(11-14)6-8-2-4-9(13)5-3-8/h2-5,13-14H,6H2,1H3/b11-10+
