5460-35-5 Usage
Description
4-AMINONAPHTHALENE-1,2-DIONE, also known as 1,2-Naphthoquinone-4-amine, is a chemical compound with the molecular formula C10H7NO2. It is a yellow to brown crystalline powder with a melting point of 220-222°C. This naphthoquinone derivative is used as a dye intermediate and in the manufacture of pharmaceuticals. However, it is known to be toxic if ingested or inhaled, causing irritation to the respiratory system and skin, and is considered harmful to aquatic organisms. It is also a known mutagen, necessitating proper safety measures during handling.
Uses
Used in Dye Industry:
4-AMINONAPHTHALENE-1,2-DIONE is used as a dye intermediate for the production of various dyes. Its chemical properties allow it to be a key component in the synthesis of dyes that can be used in different applications, such as textiles, plastics, and printing inks.
Used in Pharmaceutical Industry:
4-AMINONAPHTHALENE-1,2-DIONE is used in the manufacture of pharmaceuticals. Its unique chemical structure makes it a valuable building block for the development of new drugs, potentially contributing to the creation of medications for various therapeutic areas.
However, due to its potential health and environmental hazards, it is crucial to implement proper safety measures when handling 4-AMINONAPHTHALENE-1,2-DIONE in both the dye and pharmaceutical industries. This includes ensuring proper ventilation, using personal protective equipment, and adhering to disposal regulations to minimize exposure and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 5460-35-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5460-35:
(6*5)+(5*4)+(4*6)+(3*0)+(2*3)+(1*5)=85
85 % 10 = 5
So 5460-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5H,11H2
