54667-43-5 Usage
Description
Poly(1,4-butanediol) bis(4-aminobenzoate) is a polymeric compound with a unique structure that consists of repeating units of 1,4-butanediol and 4-aminobenzoate. It is known for its versatile properties, such as thermal stability, mechanical strength, and chemical resistance, making it suitable for various applications across different industries.
Uses
Used in the Rubber Industry:
Poly(1,4-butanediol) bis(4-aminobenzoate) is used as a component in the production of room temperature vulcanizates (RTV) and thermally cured molded parts. Its properties contribute to the enhanced performance and durability of rubber products.
Used in Electronics Industry:
Poly(1,4-butanediol) bis(4-aminobenzoate) is used as an encapsulant for temperature-sensitive electronic components. Its thermal stability and chemical resistance provide protection to these components, ensuring their reliable performance in various environmental conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 54667-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,6,6 and 7 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 54667-43:
(7*5)+(6*4)+(5*6)+(4*6)+(3*7)+(2*4)+(1*3)=145
145 % 10 = 5
So 54667-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O4/c19-15-7-3-13(4-8-15)17(21)23-11-1-2-12-24-18(22)14-5-9-16(20)10-6-14/h3-10H,1-2,11-12,19-20H2