5471-34-1 Usage
Description
1-(2-chloronaphthalen-1-yl)ethanol is a chemical compound that belongs to the class of chloronaphthalenes, which are polycyclic aromatic compounds. It is a colorless to light yellow liquid with a slightly aromatic odor and is known for its use as a solvent and intermediate in the synthesis of other chemicals. Additionally, it exhibits antimicrobial and insecticidal properties, making it a versatile compound in various industries. However, it is crucial to handle this chemical with care due to potential health risks and environmental hazards, necessitating proper safety measures during its use and handling.
Uses
Used in Chemical Synthesis:
1-(2-chloronaphthalen-1-yl)ethanol is used as an intermediate in the chemical synthesis industry for the production of various compounds. Its unique structure allows it to serve as a building block for creating a range of chemical products, contributing to the diversity of synthesized materials.
Used as a Solvent:
In the chemical and pharmaceutical industries, 1-(2-chloronaphthalen-1-yl)ethanol is utilized as a solvent due to its ability to dissolve a wide range of substances. Its solvent properties make it a valuable component in the formulation of various products, including paints, coatings, and pharmaceutical formulations.
Used in Antimicrobial Applications:
1-(2-chloronaphthalen-1-yl)ethanol is used as an antimicrobial agent in the medical and pharmaceutical sectors. Its antimicrobial properties help in inhibiting the growth of harmful microorganisms, making it a useful component in the development of disinfectants, sanitizers, and preservatives.
Used in Insecticidal Applications:
The insecticidal properties of 1-(2-chloronaphthalen-1-yl)ethanol make it a valuable component in the agricultural industry. It can be used in the development of insecticides to control pests and protect crops, contributing to increased agricultural productivity and reduced crop damage.
Check Digit Verification of cas no
The CAS Registry Mumber 5471-34-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,7 and 1 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5471-34:
(6*5)+(5*4)+(4*7)+(3*1)+(2*3)+(1*4)=91
91 % 10 = 1
So 5471-34-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClO/c1-8(14)12-10-5-3-2-4-9(10)6-7-11(12)13/h2-8,14H,1H3
