54746-50-8 Usage
Description
Gamma-butenyl-(beta-propenyl)nitrosamine, also known as 3-butenyl(2-propenyl)nitrosamine, is a volatile nitrosamine compound that is primarily formed during the nitrosation process of certain organic compounds, such as spermidine or spermine. It is a significant compound in the field of chemistry due to its formation and potential applications in various industries.
Uses
Used in Chemical Research:
Gamma-butenyl-(beta-propenyl)nitrosamine is used as a research compound for studying the nitrosation process and its effects on organic compounds like spermidine and spermine. Understanding the formation and properties of this compound can contribute to the development of new chemical reactions and products.
Used in Analytical Chemistry:
In the field of analytical chemistry, gamma-butenyl-(beta-propenyl)nitrosamine can be used as a reference compound for the detection and quantification of volatile nitrosamines in various samples. Its unique properties make it a valuable tool for researchers working on nitrosamine analysis and detection methods.
Used in Pharmaceutical Industry:
Gamma-butenyl-(beta-propenyl)nitrosamine may have potential applications in the pharmaceutical industry, particularly in the development of new drugs or drug delivery systems. Its formation during the nitrosation of certain compounds could provide insights into the design of novel therapeutic agents or drug candidates.
Used in Environmental Monitoring:
Due to its formation in the nitrosation process, gamma-butenyl-(beta-propenyl)nitrosamine can be used as an indicator compound for monitoring environmental contamination by nitrosamines. This can help in assessing the presence of these potentially harmful compounds in the environment and developing strategies for their mitigation.
Check Digit Verification of cas no
The CAS Registry Mumber 54746-50-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,7,4 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 54746-50:
(7*5)+(6*4)+(5*7)+(4*4)+(3*6)+(2*5)+(1*0)=138
138 % 10 = 8
So 54746-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O/c1-3-5-7-9(8-10)6-4-2/h3-4H,1-2,5-7H2
