54786-86-6 Usage
Description
Octahydro-2-nitrosocyclopenta[c]pyrrole is a heterocyclic compound with a unique structure that features a cyclopenta[c]pyrrole ring fused with an octahydro ring. It is characterized by the presence of a nitroso group (-N=O) attached to the nitrogen atom in the azabicyclooctane moiety. octahydro-2-nitrosocyclopenta[c]pyrrole is known for its potential applications in the synthesis of various pharmaceutical compounds, particularly ureas.
Uses
Used in Pharmaceutical Industry:
Octahydro-2-nitrosocyclopenta[c]pyrrole is used as an intermediate in the synthesis of various ureas and other pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, octahydro-2-nitrosocyclopenta[c]pyrrole serves as a versatile starting material for the preparation of a wide range of organic compounds. Its ability to undergo various chemical reactions, such as nucleophilic substitution, electrophilic addition, and reductive amination, allows for the creation of diverse molecular structures with potential applications in various industries.
Used in Medicinal Chemistry:
Octahydro-2-nitrosocyclopenta[c]pyrrole is utilized in medicinal chemistry for the design and synthesis of novel bioactive molecules. Its unique structural features and functional groups enable the development of compounds with specific biological activities, such as enzyme inhibition, receptor modulation, or other pharmacological effects. This makes it a promising candidate for the discovery of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 54786-86-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,7,8 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54786-86:
(7*5)+(6*4)+(5*7)+(4*8)+(3*6)+(2*8)+(1*6)=166
166 % 10 = 6
So 54786-86-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O/c10-8-9-4-6-2-1-3-7(6)5-9/h6-7H,1-5H2
54786-86-6Relevant articles and documents
New method for preparing gliclazide intermediate
-
Paragraph 0008; 0019; 0020; 0027; 0030; 0033, (2017/06/02)
The invention discloses a new method for preparing a gliclazide intermediate, and particularly relates to a preparation method for a blood sugar lowering medicine gliclazide intermediate 2-amino octahydrocyclopenta[c]pyrrole. The method sequentially includes the following steps that octahydrocyclopenta[c]pyrrole is adopted as a raw material, and the product is obtained sequentially through nitrosation and a reduction reaction. Conditions of a brand-new reduction reaction are provided, the raw material for use is wide and sufficient in source, the price is low, the reaction condition is mild, the process is simple, all steps of the reaction are conventional operation, and the production cost is reduced.
