553672-05-2 Usage
General Description
5-Amino-3-cyclohexyl-1-methyl-1H-pyrazole-4-carbonitrile is a chemical compound with the molecular formula C11H15N5. It is a pyrazole derivative with a cyclohexyl and a methyl group attached to the nitrogen atom. 5-Amino-3-cyclohexyl-1-methyl-1H-pyrazole-4-carbonitrile is commonly used in medicinal chemistry as a building block for the synthesis of various biologically active molecules. It has been researched for its potential pharmacological properties, including as an analgesic, anti-inflammatory, and antitumor agent. Its unique structure and properties make it a valuable tool for the development of new drugs and chemical compounds with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 553672-05-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,5,3,6,7 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 553672-05:
(8*5)+(7*5)+(6*3)+(5*6)+(4*7)+(3*2)+(2*0)+(1*5)=162
162 % 10 = 2
So 553672-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N4/c1-15-11(13)9(7-12)10(14-15)8-5-3-2-4-6-8/h8H,2-6,13H2,1H3
553672-05-2Relevant articles and documents
PYRIDINYLPYRAZOLOPYRIMIDINONE DERIVATIVES AS PDE 7 INHIBITORS
-
Page 29, (2008/06/13)
To provide the compounds inhibiting PDE 7 selectively, and therefore, enhance cellular cAMP level. Consequently, the compound is useful for treating various kinds of disease such as allergic disease, inflammatory disease or immunologic disease. The compound is pyridinylpyrazolopyrimidinone compound represented by the following formula (IA) or (IB): especially, R1 is cyclohexyl or cycloheptyl group, R2 is methyl; R3 is a group: -NR5R6 or -S(O)0-2R8; hydrogen atom; nitro group; cyano group; a halogen atom; heteroaryl group; and R4 is methoxy or ethoxy group.
