55682-64-9 Usage
Description
(3E,5Z)-2,7-Dimethyl-3,5-octadiene is an unsaturated hydrocarbon with a molecular formula of C10H18. It is a naturally occurring chemical compound found in various fruits and flowers, contributing to their characteristic scents. Its unique molecular structure and pleasant odor make it a valuable ingredient in the formulation of various consumer products.
Uses
Used in Fragrance Industry:
(3E,5Z)-2,7-Dimethyl-3,5-octadiene is used as a fragrance ingredient for its pleasant odor and ability to enhance the scent of other compounds. It is commonly used as a component in perfumes, contributing to their unique and appealing scents.
Used in Flavor Industry:
(3E,5Z)-2,7-Dimethyl-3,5-octadiene is used as a flavoring agent in the production of food flavorings. Its natural occurrence in fruits and flowers allows it to impart a desirable taste and aroma to various food products.
Used in Chemical Synthesis:
(3E,5Z)-2,7-Dimethyl-3,5-octadiene is also used in chemical synthesis for the production of other organic compounds. Its unique molecular structure makes it a valuable building block for the synthesis of various chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 55682-64-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,6,8 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 55682-64:
(7*5)+(6*5)+(5*6)+(4*8)+(3*2)+(2*6)+(1*4)=149
149 % 10 = 9
So 55682-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H18/c1-9(2)7-5-6-8-10(3)4/h5-10H,1-4H3/b7-5-,8-6+
