55822-82-7 Usage
Description
3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester is an organic compound with a unique chemical structure that features a chloroalanine core, a phenylmethoxycarbonyl group, and a phenylmethyl ester moiety. 3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester is characterized by its white solid appearance and is known for its potential applications in various fields, particularly in organic synthesis.
Uses
Used in Organic Synthesis:
3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of a wide range of products, making it a valuable building block in the development of new molecules with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester is used as a starting material for the development of new drugs. Its chemical properties and reactivity enable the creation of novel drug candidates with potential therapeutic benefits.
Used in Chemical Research:
3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester is also utilized in chemical research to study the properties and reactions of various functional groups. 3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester serves as a model system for understanding the behavior of similar structures and can provide insights into the design and synthesis of new molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 55822-82-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,2 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 55822-82:
(7*5)+(6*5)+(5*8)+(4*2)+(3*2)+(2*8)+(1*2)=137
137 % 10 = 7
So 55822-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H18ClNO4/c19-11-16(17(21)23-12-14-7-3-1-4-8-14)20-18(22)24-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,22)/t16-/m0/s1