55933-94-3 Usage
Description
(3,5,6-Trichloro-pyridin-2-yl)-hydrazine, with the molecular formula C5H3Cl3N4, is a hydrazine derivative featuring a trichloro-pyridine group attached to the hydrazine molecule. This chemical compound is known for its potential applications in various fields, including organic synthesis, pharmaceutical research, and as a building block for creating other chemical compounds.
Uses
Used in Organic Synthesis:
(3,5,6-Trichloro-pyridin-2-yl)-hydrazine is used as a building block in organic synthesis for the creation of other chemical compounds. Its unique structure allows it to be a valuable component in the development of new molecules with specific properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (3,5,6-Trichloro-pyridin-2-yl)-hydrazine is utilized in research for its potential to contribute to the development of new drugs. Its chemical properties make it a candidate for further exploration and synthesis of medicinal compounds.
Used as a Fungicide:
(3,5,6-Trichloro-pyridin-2-yl)-hydrazine has been studied for its potential use as a fungicide, indicating its possible application in agriculture and crop protection to control fungal infections.
Used as a Herbicide:
Similarly, this compound has been considered for use as a herbicide, suggesting its potential role in controlling unwanted plant growth in various settings.
Used in Material Development:
(3,5,6-Trichloro-pyridin-2-yl)-hydrazine may also have potential applications in the development of new materials, given its unique chemical structure and properties.
Used in Biological Research:
Furthermore, this compound could be employed in biological research to study its interactions with biological systems and explore its potential effects on various organisms.
It is crucial to handle (3,5,6-Trichloro-pyridin-2-yl)-hydrazine with care due to its potential hazards, and appropriate safety measures should be taken when working with it to ensure the safety of researchers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 55933-94-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,3 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 55933-94:
(7*5)+(6*5)+(5*9)+(4*3)+(3*3)+(2*9)+(1*4)=153
153 % 10 = 3
So 55933-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Cl3N3/c6-2-1-3(7)5(11-9)10-4(2)8/h1H,9H2,(H,10,11)
55933-94-3Relevant articles and documents
Method for synthesizing 2, 3, 5-trichloropyridine
-
Paragraph 0008; 0027-0028; 0030-0031; 0033-0034; 0036-0037, (2019/01/07)
The invention discloses a method for synthesizing 2, 3, 5-trichloropyridine. The method mainly comprises: (1) synthesis of 2, 3, 5-trichloro-6-hydrated hydrazinyl pyridine: adding hydrazine hydrate and a reaction solvent into 2, 3, 5, 6-tetrachloropyridine as a raw material, carrying out a reaction process at a certain temperature for some time and carrying out treatment to obtain 2, 3, 5-trichloro-6-hydrated hydrazinyl pyridine, and (2) reaction of 2, 3, 5-trichloro-6-hydrated hydrazinyl pyridine and a sodium hypochlorite aqueous solution in an alkaline environment at a certain temperature for a certain period of time, then treatment and reduced pressure distillation. The method has the advantages of low reaction raw material price, no high toxic, no irritation, small three waste amount,environmentally friendly processes, relatively thorough reaction, simple process control and high product yield.
