56015-31-7 Usage
General Description
3-Bromo-4,7-diazaindole is a chemical compound with the molecular formula C8H5BrN2. It is a halogen-substituted diazaindole derivative that is used in various research and industrial applications. 3-Bromo-4,7-diazaindole has potential applications in the pharmaceutical industry, particularly in the development of new drugs and medicines. Its unique chemical properties and structure make it a desirable candidate for further exploration and research. Additionally, 3-Bromo-4,7-diazaindole is used in organic synthesis and as a building block for the creation of more complex molecules. Its presence in scientific literature and its potential for further study highlight its significance in the field of chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 56015-31-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,1 and 5 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 56015-31:
(7*5)+(6*6)+(5*0)+(4*1)+(3*5)+(2*3)+(1*1)=97
97 % 10 = 7
So 56015-31-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3/c7-4-3-10-6-5(4)8-1-2-9-6/h1-3H,(H,9,10)