5638-06-2 Usage
General Description
Heptacosane-1,27-dioic acid is a long-chain carboxylic acid that contains 27 carbons and two carboxylic acid functional groups. It is a saturated compound, meaning that all of its carbon-carbon bonds are single bonds. This chemical is often used in the synthesis of various organic compounds, particularly in the production of polymers and surfactants. It has potential applications as a lubricant additive, plasticizer, or corrosion inhibitor due to its long hydrocarbon chain length and ability to form stable complexes with other molecules. Additionally, heptacosane-1,27-dioic acid may have potential bioactive properties and biological activities that warrant further study.
Check Digit Verification of cas no
The CAS Registry Mumber 5638-06-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,3 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5638-06:
(6*5)+(5*6)+(4*3)+(3*8)+(2*0)+(1*6)=102
102 % 10 = 2
So 5638-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H52O4/c28-26(29)24-22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21-23-25-27(30)31/h1-25H2,(H,28,29)(H,30,31)