56501-70-3 Usage
Description
L-Acosaminehydrochloride, also known as the amino sugar component of the antibiotic actinodin, is an off-white low melting solid. It is a significant compound due to its role in the composition of actinodin, which is a potent antibiotic with various applications in the medical field.
Uses
Used in Pharmaceutical Industry:
L-Acosaminehydrochloride is used as an active pharmaceutical ingredient for the development of antibiotics, specifically actinodin. Its role in the antibiotic's structure contributes to its effectiveness in treating bacterial infections.
Used in Research and Development:
L-Acosaminehydrochloride is utilized as a key component in the research and development of new antibiotics and pharmaceutical compounds. Its unique chemical properties and role in actinodin make it a valuable compound for further study and potential applications in the medical field.
Used in Drug Synthesis:
L-Acosaminehydrochloride is employed as a starting material or intermediate in the synthesis of various pharmaceutical compounds, particularly those with antibiotic properties. Its presence in the structure of actinodin highlights its importance in the development of new drugs to combat bacterial resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 56501-70-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,0 and 1 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 56501-70:
(7*5)+(6*6)+(5*5)+(4*0)+(3*1)+(2*7)+(1*0)=113
113 % 10 = 3
So 56501-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO3.ClH/c1-4(9)6(10)5(7)2-3-8;/h3-6,9-10H,2,7H2,1H3;1H/t4-,5-,6-;/m0./s1
