565165-44-8 Usage
Description
1-(4-ACETYL-PIPERAZIN-1-YL)-2-CHLORO-ETHANONE is a chemical compound with the molecular formula C8H13ClN2O. It is a derivative of piperazine, a heterocyclic organic compound commonly used in pharmaceuticals and pesticides. 1-(4-ACETYL-PIPERAZIN-1-YL)-2-CHLORO-ETHANONE contains an acetyl group and a chloro group, which are both commonly found in organic molecules and can have various chemical properties and reactivities. The presence of piperazine in the compound suggests potential medicinal or biological activities, as piperazine derivatives have been investigated for their pharmaceutical properties, including as antipsychotic and anxiolytic agents. The specific properties and potential applications of 1-(4-acetyl-piperazin-1-yl)-2-chloro-ethanone would need to be determined through further research and testing.
Uses
Used in Pharmaceutical Industry:
1-(4-ACETYL-PIPERAZIN-1-YL)-2-CHLORO-ETHANONE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its piperazine derivative nature. Its potential medicinal or biological activities make it a promising candidate for the development of new drugs, particularly in the areas of antipsychotic and anxiolytic agents.
Used in Pesticide Industry:
1-(4-ACETYL-PIPERAZIN-1-YL)-2-CHLORO-ETHANONE is also used as a chemical intermediate in the development of pesticides. Its specific application in this industry would depend on the results of further research and testing to determine its effectiveness and safety as a pesticide component.
Check Digit Verification of cas no
The CAS Registry Mumber 565165-44-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,6,5,1,6 and 5 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 565165-44:
(8*5)+(7*6)+(6*5)+(5*1)+(4*6)+(3*5)+(2*4)+(1*4)=168
168 % 10 = 8
So 565165-44-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H13ClN2O2/c1-7(12)10-2-4-11(5-3-10)8(13)6-9/h2-6H2,1H3
565165-44-8Relevant articles and documents
Indoles and 1-(3-(benzyloxy)benzyl)piperazines: Reversible and selective monoamine oxidase B inhibitors identified by screening an in-house compound library
?akelj, Simon,Frlan, Rok,Gobec, Stanislav,Hrast, Martina,Knez, Damijan,Kos, Janko,Pi?lar, Anja
, (2022/01/27)
The therapeutic indications for monoamine oxidases A and B (MAO-A and MAO-B) inhibitors that have emerged from biological studies on animal and cellular models of neurological and oncological diseases have focused drug discovery projects upon identifying
