57028-32-7 Usage
Chemical class
Belongs to the anthraquinone class of chemical compounds.
Plant source
Found in various plant sources, particularly in the leaves of the Morus alba plant.
Biological activities
Studied for its potential antioxidant and anti-inflammatory properties.
Anti-cancer properties
Shown to inhibit the proliferation of cancer cells, indicating potential anti-cancer properties.
Pharmaceutical applications
Being investigated for its potential application in the development of new pharmaceuticals.
Nutraceutical applications
Also being explored for its potential use in the development of new nutraceuticals.
These properties and contents provide a comprehensive overview of the characteristics and potential applications of 10-hydroxy-10-(4-methoxyphenyl)anthracen-9-one, or Morin.
Check Digit Verification of cas no
The CAS Registry Mumber 57028-32-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,0,2 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 57028-32:
(7*5)+(6*7)+(5*0)+(4*2)+(3*8)+(2*3)+(1*2)=117
117 % 10 = 7
So 57028-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H16O3/c1-24-15-12-10-14(11-13-15)21(23)18-8-4-2-6-16(18)20(22)17-7-3-5-9-19(17)21/h2-13,23H,1H3