57153-43-2 Usage
General Description
The chemical "(4-Methyl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)acetic acid" is a synthetic compound with a molecular formula C12H14O3S. It is an acetic acid derivative with a thieno[3,2-c]pyran ring system, which is commonly used in pharmaceutical research and drug development. (4-Methyl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)acetic acid has potential therapeutic applications due to its ability to modulate biological pathways and interact with specific targets in the body. Its unique structure and properties make it a promising candidate for further exploration in the development of new drugs for various diseases and conditions. Additionally, the compound’s chemical structure and properties make it a valuable tool for studying biological processes and mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 57153-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,5 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57153-43:
(7*5)+(6*7)+(5*1)+(4*5)+(3*3)+(2*4)+(1*3)=122
122 % 10 = 2
So 57153-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O3S/c1-10(6-9(11)12)7-3-5-14-8(7)2-4-13-10/h3,5H,2,4,6H2,1H3,(H,11,12)