572923-26-3 Usage
Description
(S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL, an organic compound belonging to the class of amino alcohols, is characterized by its unique structure featuring a phenyl group and a p-tolylamino group attached to a chiral carbon atom, which provides it with a stereocenter. (S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL is known for its potential applications in the pharmaceutical and chemical industries due to its versatile nature and unique properties.
Uses
Used in Pharmaceutical Industry:
(S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL is used as a building block for the synthesis of various pharmaceuticals and fine chemicals. Its application is attributed to its unique structure, which allows for the creation of a wide range of compounds with potential therapeutic effects.
Used in Medicinal Chemistry:
(S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL is utilized in the development and study of treatments for various medical conditions, such as neurological disorders and cardiovascular diseases. Its potential use in these areas is due to its ability to interact with specific biological targets and modulate their activity.
Used in Asymmetric Synthesis and Catalysis:
(S)-2-PHENYL-2-P-TOLYLAMINO-ETHANOL serves as a chiral ligand in asymmetric synthesis and catalysis. Its application in this field is a result of its stereocenter, which enables the creation of enantiomerically pure compounds with potential applications in various industries, including pharmaceuticals and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 572923-26-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,2 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 572923-26:
(8*5)+(7*7)+(6*2)+(5*9)+(4*2)+(3*3)+(2*2)+(1*6)=173
173 % 10 = 3
So 572923-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c1-12-7-9-14(10-8-12)16-15(11-17)13-5-3-2-4-6-13/h2-10,15-17H,11H2,1H3/t15-/m1/s1