57461-34-4 Usage
Description
H-ASN-OME HCL, also known as L-Asparagine methyl ester hydrochloride, is a protected form of L-Asparagine (A790005). L-Asparagine is an amino acid that was first isolated by Robiquet and Vauquelin from asparagus juice, which is a high source of L-asparagine. It is commonly incorporated into proteins and serves as a foundation for certain cancer therapies, as specific cancerous cells rely on L-asparagine for their growth. H-ASN-OME HCL is a white solid and is used in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
H-ASN-OME HCL is used as a building block for the synthesis of various pharmaceutical compounds, particularly those targeting cancer cells. Its role in cancer therapies is due to the fact that certain cancerous cells require L-asparagine for their growth, making it a potential therapeutic agent.
Used in Biochemical Research:
In the field of biochemical research, H-ASN-OME HCL is utilized as a research tool to study the role of L-asparagine in protein synthesis and its involvement in cellular processes. This helps researchers understand the underlying mechanisms of various diseases and develop targeted therapies.
Used in Drug Development:
H-ASN-OME HCL is employed in the development of new drugs, particularly those aimed at treating cancer. Its protected form allows for the exploration of novel drug candidates that can potentially disrupt the growth of cancerous cells by targeting their reliance on L-asparagine.
Used in Diagnostic Applications:
In the diagnostic industry, H-ASN-OME HCL can be used to develop tests that detect the presence of specific cancerous cells or monitor the effectiveness of cancer therapies. Its unique properties make it a valuable tool for the early detection and monitoring of certain types of cancer.
Used in Nutritional Supplements:
H-ASN-OME HCL may also find application in the development of nutritional supplements, particularly those designed to support protein synthesis and overall health. Its role in protein incorporation makes it a potential candidate for supplements aimed at enhancing athletic performance or promoting muscle growth.
Check Digit Verification of cas no
The CAS Registry Mumber 57461-34-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,4,6 and 1 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57461-34:
(7*5)+(6*7)+(5*4)+(4*6)+(3*1)+(2*3)+(1*4)=134
134 % 10 = 4
So 57461-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O3.ClH/c1-10-5(9)3(6)2-4(7)8;/h3H,2,6H2,1H3,(H2,7,8);1H/t3-;/m0./s1
