57712-62-6 Usage
Description
1-Benzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is an organic compound with the molecular formula C11H9N3O2. It is a derivative of pyrimidine, a heterocyclic compound with potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
1-Benzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is used as a reactant in the preparation of pyrimidinedione, pyrimidinetrione, triazinedione, and tetrahydroquinazolinedione derivatives. These derivatives have potential applications as α1-adrenoceptor antagonists, which are important in the development of medications for various conditions, such as hypertension and benign prostatic hyperplasia.
Check Digit Verification of cas no
The CAS Registry Mumber 57712-62-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,7,1 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 57712-62:
(7*5)+(6*7)+(5*7)+(4*1)+(3*2)+(2*6)+(1*2)=136
136 % 10 = 6
So 57712-62-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H9N3O2/c13-6-10-8-15(12(17)14-11(10)16)7-9-4-2-1-3-5-9/h1-5,8H,7H2,(H,14,16,17)