5788-60-3 Usage
General Description
3-Chloro-6-Propyloxypyridazine is a chemical compound that generally falls under the category of pyridazines, which are heterocyclic compounds featuring two nitrogen atoms in their ring. While there isn't abundant specific information available on this particular chemical, pyridazine derivatives overall are known to have significant physiological activities, with applications in medicinal chemistry, such as antimicrobial, anti-inflammatory, analgesic, and antipyretic capacities. The exact properties and uses of 3-Chloro-6-Propyloxypyridazine would likely be dependent on more specific studies and tests.
Check Digit Verification of cas no
The CAS Registry Mumber 5788-60-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,8 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5788-60:
(6*5)+(5*7)+(4*8)+(3*8)+(2*6)+(1*0)=133
133 % 10 = 3
So 5788-60-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H9ClN2O/c1-2-5-11-7-4-3-6(8)9-10-7/h3-4H,2,5H2,1H3
