58089-32-0 Usage
Description
(1,3-Benzoxazol-2-ylthio)acetic acid is a chemical compound with the molecular formula C10H7NO3S. It is a benzoxazole derivative with a thioacetic acid group attached to the benzoxazole ring. (1,3-BENZOXAZOL-2-YLTHIO)ACETIC ACID is characterized by its unique structure and potential pharmacological properties, making it a valuable tool in the field of medicinal and synthetic chemistry.
Uses
Used in Pharmaceutical Research and Development:
(1,3-Benzoxazol-2-ylthio)acetic acid is used as a potential drug candidate in pharmaceutical research and development. Its unique structure and potential pharmacological properties make it a promising candidate for the development of new therapeutic agents.
Used in Organic Synthesis:
(1,3-Benzoxazol-2-ylthio)acetic acid is also used as a reagent in organic synthesis for the preparation of various heterocyclic compounds. Its chemical structure and properties make it a valuable tool for the synthesis of complex organic molecules and contribute to the advancement of synthetic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 58089-32-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,0,8 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 58089-32:
(7*5)+(6*8)+(5*0)+(4*8)+(3*9)+(2*3)+(1*2)=150
150 % 10 = 0
So 58089-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3S/c11-8(12)5-14-9-10-6-3-1-2-4-7(6)13-9/h1-4H,5H2,(H,11,12)/p-1
58089-32-0Relevant articles and documents
Synthesis and neurotropic properties of 2-(carboxymethylthio) derivatives of benzimidazole, benzothiazole and their ammonium salts
Bakhareva,Voronkov,Sorokin,Lopyrev,Seredenin,Gaidarov
, p. 89 - 91 (1996)
-
Synthesis of Benzoxazolylthiomethyl and Benzthiazolylthiomethyl Quinazolin-4(3 h)-ones
Rafeeq, Mohammad,Ramana Reddy, Chittireddy Venkata,Dubey, Pramod Kumar
, p. 1857 - 1864 (2015/12/12)
o-Aminophenol (1a, X = O) or o-aminothiophenol (1b, X = S) was reacted with carbon disulfide in ethanol containing KOH under reflux to obtain 2-mercaptobenzoxazole (2a, X = O) and 2-mercaptobenzthiazole (2b, X = S), respectively. Condensation of 2a and 2b each with chloroacetic acid gave 2-(benzoxazol-2-ylthio)acetic acid (3a, X = O) and 2-(benzthiazol-2-ylthio)acetic acid (3b, X = S) respectively which with anthranilamide gave 2-((benzoxal-2-ylthio)methyl) quinazolin-4(3H)-one (5a, X = O) and 2-((benzthiazol-2-ylthio)methyl)quinazolin-4(3H)-one (5b, X = S) respectively. The products 5a,b could be prepared in three other routes involving the general sequences 6→2→5, 6→7→5 and 8→9→5.
Some azolythioacetamides and their analgesic and antiinflammatory activities
Smsek, Rahime,Kelicen,Safak,Akguen,Demirdamar
, p. 229 - 231 (2007/10/03)
-