58161-36-7 Usage
General Description
N-(3-oxo-2,3-dihydro-1H-inden-4-yl)acetamide is a chemical compound with the molecular formula C13H11NO2. It is an aromatic amide derived from the indane ring system and contains both a carbonyl group and an amide group. N-(3-oxo-2,3-dihydro-1H-inden-4-yl)acetamide is commonly used in organic synthesis and pharmaceutical research due to its unique structural features and potential pharmacological properties. Its specific applications include its use as a building block in the synthesis of various biologically active molecules and as a potential lead compound in drug discovery. Additionally, it may also be used as a precursor in the production of various organic compounds for industrial and academic research purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 58161-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,6 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 58161-36:
(7*5)+(6*8)+(5*1)+(4*6)+(3*1)+(2*3)+(1*6)=127
127 % 10 = 7
So 58161-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2/c1-7(13)12-9-4-2-3-8-5-6-10(14)11(8)9/h2-4H,5-6H2,1H3,(H,12,13)
