58403-03-5 Usage
General Description
2-(2-Chlorophenoxy)ethanimidamide hydrochloride, also known as mecoprop, is a synthetic organic compound primarily used as a herbicide. It is a white crystalline solid that is soluble in water and commonly used in agriculture to control broadleaf weeds in crops such as cereals, grasslands, and turf. Mecoprop works by mimicking the action of the plant growth hormone auxin, leading to uncontrolled growth and eventually death of the targeted plants. It is considered to have low toxicity to mammals, but may have adverse effects on aquatic organisms and bees. Mecoprop is regulated in some countries due to its potential environmental impact and safety concerns.
Check Digit Verification of cas no
The CAS Registry Mumber 58403-03-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,4,0 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 58403-03:
(7*5)+(6*8)+(5*4)+(4*0)+(3*3)+(2*0)+(1*3)=115
115 % 10 = 5
So 58403-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2O.ClH/c9-6-3-1-2-4-7(6)12-5-8(10)11;/h1-4H,5H2,(H3,10,11);1H
Xn:Harmful;
