58756-27-7 Usage
Description
4-PHENYL-1,2,3-THIADIAZOLE-5-CARBOHYDRAZIDE is a chemical compound that belongs to the class of thiadiazole derivatives. It has the molecular formula C10H8N4OS and a molar mass of 236.26 g/mol. 4-PHENYL-1,2,3-THIADIAZOLE-5-CARBOHYDRAZIDE is characterized by its structure, which includes a thiadiazole ring with a phenyl group attached to it, along with a carbohydrazide functional group. It possesses potential pharmacological properties and is being studied for its potential use in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
4-PHENYL-1,2,3-THIADIAZOLE-5-CARBOHYDRAZIDE is used as an intermediate for the synthesis of pharmaceuticals and other organic compounds. Its unique structure and potential pharmacological properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Chemistry:
In the field of organic chemistry, 4-PHENYL-1,2,3-THIADIAZOLE-5-CARBOHYDRAZIDE serves as a key intermediate for the synthesis of various organic compounds. Its versatility in chemical reactions allows for the creation of a wide range of molecules with diverse applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 58756-27-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,7,5 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58756-27:
(7*5)+(6*8)+(5*7)+(4*5)+(3*6)+(2*2)+(1*7)=167
167 % 10 = 7
So 58756-27-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N4OS/c10-11-9(14)8-7(12-13-15-8)6-4-2-1-3-5-6/h1-5H,10H2,(H,11,14)
