58976-46-8 Usage
General Description
The chemical sequence "ALA-GLY-CYS-LYS-ASN-PHE-PHE-D-TRP-LYS-THR-PHE-THR-SER-CYS" is a peptide composed of the amino acids alanine, glycine, cysteine, lysine, asparagine, phenylalanine, D-tryptophan, threonine, and serine. Peptides are essential molecules in biological systems, and this specific sequence could potentially have various functions within the body. The presence of specific amino acids like cysteine and lysine indicate possible protein-structuring roles, while the aromatic amino acids phenylalanine and tryptophan suggest potential interactions with other molecules. The sequence may also have potential therapeutic or pharmaceutical applications, depending on its specific properties and interactions with other molecules. Overall, the sequence "ALA-GLY-CYS-LYS-ASN-PHE-PHE-D-TRP-LYS-THR-PHE-THR-SER-CYS" represents an important molecular entity with diverse potential biological and biochemical roles.
Check Digit Verification of cas no
The CAS Registry Mumber 58976-46-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,9,7 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 58976-46:
(7*5)+(6*8)+(5*9)+(4*7)+(3*6)+(2*4)+(1*6)=188
188 % 10 = 8
So 58976-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C76H104N18O19S2/c1-41(79)64(100)82-37-61(99)83-58-39-114-115-40-59(76(112)113)92-72(108)57(38-95)91-75(111)63(43(3)97)94-71(107)54(33-46-23-11-6-12-24-46)90-74(110)62(42(2)96)93-66(102)51(28-16-18-30-78)84-69(105)55(34-47-36-81-49-26-14-13-25-48(47)49)88-68(104)53(32-45-21-9-5-10-22-45)86-67(103)52(31-44-19-7-4-8-20-44)87-70(106)56(35-60(80)98)89-65(101)50(85-73(58)109)27-15-17-29-77/h4-14,19-26,36,41-43,50-59,62-63,81,95-97H,15-18,27-35,37-40,77-79H2,1-3H3,(H2,80,98)(H,82,100)(H,83,99)(H,84,105)(H,85,109)(H,86,103)(H,87,106)(H,88,104)(H,89,101)(H,90,110)(H,91,111)(H,92,108)(H,93,102)(H,94,107)(H,112,113)/t41-,42?,43?,50-,51-,52-,53-,54-,55+,56-,57-,58-,59-,62-,63-/m0/s1
58976-46-8Relevant articles and documents
Fine-tuning the π-π Aromatic interactions in peptides: Somatostatin analogues containing mesityl alanine
Martin-Gago, Pablo,Gomez-Caminals, Marc,Ramon, Rosario,Verdaguer, Xavier,Martin-Malpartida, Pau,Aragon, Eric,Fernandez-Carneado, Jimena,Ponsati, Berta,Lopez-Ruiz, Pilar,Cortes, Maria Alicia,Colas, Begona,MacIas, Maria J.,Riera, Antoni
supporting information; experimental part, p. 1820 - 1825 (2012/04/04)
Going through the motions: Somatostatin analogues having greater conformational rigidity than somatostatin have been prepared by substituting Phe residues in the native sequence with mesityl alanine (Msa; see structure). The analogues show high affinity f