59122-93-9 Usage
Description
Neoisoliquiritin is a naturally occurring compound derived from the roots of the Chinese herb Anemarrhena asphodeloides. It possesses various biological activities, including anti-inflammatory, antioxidant, and anti-cancer properties. Its chemical structure allows it to interact with specific cellular targets, making it a promising candidate for pharmaceutical applications.
Uses
Used in Anticancer Applications:
Neoisoliquiritin is used as an anticancer agent for targeting GRP78-β-catenin signaling in human breast cancer cell xenograft mouse models. It inhibits tumor progression by modulating this signaling pathway, which plays a crucial role in cancer cell survival and proliferation.
Used in Cancer Chemoprevention:
Neoisoliquiritin is also used as a cancer chemopreventive agent. It exhibits potential in preventing the development and progression of cancer by targeting specific molecular pathways involved in carcinogenesis. Its antioxidant and anti-inflammatory properties further contribute to its chemopreventive effects.
Check Digit Verification of cas no
The CAS Registry Mumber 59122-93-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,2 and 2 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 59122-93:
(7*5)+(6*9)+(5*1)+(4*2)+(3*2)+(2*9)+(1*3)=129
129 % 10 = 9
So 59122-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-6-7-14(16(25)9-13)15(24)8-3-11-1-4-12(23)5-2-11/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1