59480-92-1 Usage
Description
2,5-DIMETHYL-3-PYRROLINE is a clear colorless to slightly yellow liquid that is utilized in various applications across different industries due to its unique chemical properties.
Uses
Used in Chemical Synthesis:
2,5-DIMETHYL-3-PYRROLINE is used as a chemical intermediate for the synthesis of pyrolyzed M–Nx/C ORR (oxygen reduction reaction) catalyst. Its role in this application is to facilitate the creation of a catalyst that can effectively improve the efficiency of oxygen reduction reactions, which are crucial in various energy-related processes.
Used in Pharmaceutical Industry:
2,5-DIMETHYL-3-PYRROLINE is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, potentially contributing to advancements in medicine.
Used in Flavor and Fragrance Industry:
2,5-DIMETHYL-3-PYRROLINE is used as a component in the creation of specific fragrances and flavors. Its distinct chemical properties enable it to contribute to the development of unique scents and tastes, enhancing the sensory experience of various products.
Used in Research and Development:
2,5-DIMETHYL-3-PYRROLINE is used as a research compound for studying its properties and potential applications in various fields. Its versatility and unique characteristics make it an interesting subject for scientific exploration and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 59480-92-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,4,8 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59480-92:
(7*5)+(6*9)+(5*4)+(4*8)+(3*0)+(2*9)+(1*2)=161
161 % 10 = 1
So 59480-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N/c1-5-3-4-6(2)7-5/h3-7H,1-2H3/p+1/t5-,6-/m0/s1
59480-92-1Relevant articles and documents
Combining chiral elements: A novel approach to asymmetric phase-transfer catalyst design
Kowtoniuk, Walter E.,MacFarland, Darren K.,Grover, Gregory N.
, p. 5703 - 5705 (2007/10/03)
A new dicationic asymmetric phase-transfer catalyst, designed by combining chiral elements, is described. Catalytic testing using standard glycine imino ester alkylations shows good yields and moderate enantioselectivities.