59486-73-6 Usage
General Description
Z-D-GLU(OBZL)-OH is a chemical compound that consists of a Z-amino acid derivative, specifically a Z-protected form of D-glutamic acid. The compound contains an ortho-benzyloxycarbonyl (OBZL) protecting group that is commonly used in organic synthesis to protect the carboxylic acid functional group of amino acids. Z-D-GLU(OBZL)-OH is often used as a building block in the synthesis of peptides and other bioactive molecules. The Z-configuration of the amino acid derivative refers to the relative positioning of the amino and carboxylic acid functional groups, which can impact the compound's reactivity and biological activity. Overall, Z-D-GLU(OBZL)-OH is a valuable chemical for the synthesis of biologically active peptides and other molecules in the field of organic chemistry and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 59486-73-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,4,8 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 59486-73:
(7*5)+(6*9)+(5*4)+(4*8)+(3*6)+(2*7)+(1*3)=176
176 % 10 = 6
So 59486-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H21NO6/c22-18(26-13-15-7-3-1-4-8-15)12-11-17(19(23)24)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,23,24)/t17-/m1/s1